EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H12O6 |
| Net Charge | 0 |
| Average Mass | 300.266 |
| Monoisotopic Mass | 300.06339 |
| SMILES | COc1cc(O)c2c(=O)cc(-c3ccc(O)c(O)c3)oc2c1 |
| InChI | InChI=1S/C16H12O6/c1-21-9-5-12(19)16-13(20)7-14(22-15(16)6-9)8-2-3-10(17)11(18)4-8/h2-7,17-19H,1H3 |
| InChIKey | RRRSSAVLTCVNIQ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Malus domestica (ncbitaxon:3750) | exocarp (BTO:0000733) | MetaboLights (MTBLS2384) | Strain: Malus x domestica Borkh. cv. Ruixue |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Luteolin 7-methyl ether (CHEBI:168675) is a ether (CHEBI:25698) |
| Luteolin 7-methyl ether (CHEBI:168675) is a flavonoids (CHEBI:72544) |
| Luteolin 7-methyl ether (CHEBI:168675) is conjugate acid of luteolin-5-olate 7-methyl ether (CHEBI:192705) |
| Incoming Relation(s) |
| luteolin-5-olate 7-methyl ether (CHEBI:192705) is conjugate base of Luteolin 7-methyl ether (CHEBI:168675) |
| IUPAC Name |
|---|
| 2-(3,4-dihydroxyphenyl)-5-hydroxy-7-methoxychromen-4-one |
| Manual Xrefs | Databases |
|---|---|
| 4476827 | ChemSpider |
| 6B5 | PDBeChem |
| HMDB0037339 | HMDB |
| LMPK12111045 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| CAS:20243-59-8 | ChemIDplus |