EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H18N2O |
| Net Charge | 0 |
| Average Mass | 266.344 |
| Monoisotopic Mass | 266.14191 |
| SMILES | CC(C)=CCc1cc2c(cc1O)nc1c(C)nccc12 |
| InChI | InChI=1S/C17H18N2O/c1-10(2)4-5-12-8-14-13-6-7-18-11(3)17(13)19-15(14)9-16(12)20/h4,6-9,19-20H,5H2,1-3H3 |
| InChIKey | WDOKVNFEDPJLPR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-(3-dimethylallyl)harmol (CHEBI:192559) has functional parent harmol (CHEBI:192558) |
| 6-(3-dimethylallyl)harmol (CHEBI:192559) is a harmala alkaloid (CHEBI:61379) |
| 6-(3-dimethylallyl)harmol (CHEBI:192559) is a indole alkaloid (CHEBI:38958) |
| UniProt Name | Source |
|---|---|
| 6-(3-dimethylallyl)harmol | UniProt |
| Citations |
|---|