EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H10N2O |
| Net Charge | 0 |
| Average Mass | 198.225 |
| Monoisotopic Mass | 198.07931 |
| SMILES | Cc1nccc2c1nc1cc(O)ccc12 |
| InChI | InChI=1S/C12H10N2O/c1-7-12-10(4-5-13-7)9-3-2-8(15)6-11(9)14-12/h2-6,14-15H,1H3 |
| InChIKey | SATMZMMKDDTOSQ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | autophagy inducer Any compound that induces the process of autophagy (the self-digestion of one or more components of a cell through the action of enzymes originating within the same cell). antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| harmol (CHEBI:192558) has functional parent β-carboline (CHEBI:109895) |
| harmol (CHEBI:192558) has role antifungal agent (CHEBI:35718) |
| harmol (CHEBI:192558) has role apoptosis inducer (CHEBI:68495) |
| harmol (CHEBI:192558) has role autophagy inducer (CHEBI:138880) |
| harmol (CHEBI:192558) is a harmala alkaloid (CHEBI:61379) |
| harmol (CHEBI:192558) is a indole alkaloid (CHEBI:38958) |
| Incoming Relation(s) |
| 6-(3-dimethylallyl)harmol (CHEBI:192559) has functional parent harmol (CHEBI:192558) |
| IUPAC Name |
|---|
| 1-methyl-9H-β-carbolin-7-ol |
| Synonym | Source |
|---|---|
| 1-methyl-9H-pyrido[3,4-b]indol-7-ol | IUPAC |
| UniProt Name | Source |
|---|---|
| harmol | UniProt |
| Citations |
|---|