EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H21N2O4 |
| Net Charge | -1 |
| Average Mass | 437.475 |
| Monoisotopic Mass | 437.15068 |
| SMILES | C=CC(C)(C)c1nc2ccccc2c1C1=C([O-])C(=O)C(c2cnc3ccccc23)=C(O)C1=O |
| InChI | InChI=1S/C27H22N2O4/c1-4-27(2,3)26-19(15-10-6-8-12-18(15)29-26)21-24(32)22(30)20(23(31)25(21)33)16-13-28-17-11-7-5-9-14(16)17/h4-13,28-30,33H,1H2,2-3H3/p-1 |
| InChIKey | BKRWGHXVQLNRMR-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| asterriquinone C1(1−) (CHEBI:192557) is a asterriquinones (CHEBI:51880) |
| asterriquinone C1(1−) (CHEBI:192557) is conjugate base of asterriquinone C1 (CHEBI:192555) |
| Incoming Relation(s) |
| asterriquinone C1 (CHEBI:192555) is conjugate acid of asterriquinone C1(1−) (CHEBI:192557) |
| UniProt Name | Source |
|---|---|
| asterriquinone C1 | UniProt |