EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H22N2O4 |
| Net Charge | 0 |
| Average Mass | 438.483 |
| Monoisotopic Mass | 438.15796 |
| SMILES | C=CC(C)(C)c1nc2ccccc2c1C1=C(O)C(=O)C(c2cnc3ccccc23)=C(O)C1=O |
| InChI | InChI=1S/C27H22N2O4/c1-4-27(2,3)26-19(15-10-6-8-12-18(15)29-26)21-24(32)22(30)20(23(31)25(21)33)16-13-28-17-11-7-5-9-14(16)17/h4-13,28-30,33H,1H2,2-3H3 |
| InChIKey | BKRWGHXVQLNRMR-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Annulohypoxylon truncatum (ncbitaxon:327061) | fruit body (BTO:0000487) | DOI (10.1016/j.tetlet.2016.04.014) | |
| Aspergillus neoafricanus (ncbitaxon:1250371) | - | DOI (10.1248/cpb.29.991) | Species also known as Aspergillus terreus var. africanus. |
| Roles Classification |
|---|
| Biological Roles: | HIV-1 reverse transcriptase inhibitor An entity which inhibits the activity of HIV-1 reverse transcriptase. Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| asterriquinone C1 (CHEBI:192555) has role Aspergillus metabolite (CHEBI:76956) |
| asterriquinone C1 (CHEBI:192555) has role HIV-1 reverse transcriptase inhibitor (CHEBI:53756) |
| asterriquinone C1 (CHEBI:192555) is a asterriquinones (CHEBI:51880) |
| asterriquinone C1 (CHEBI:192555) is a dihydroxy-1,4-benzoquinones (CHEBI:132126) |
| asterriquinone C1 (CHEBI:192555) is a olefinic compound (CHEBI:78840) |
| asterriquinone C1 (CHEBI:192555) is conjugate acid of asterriquinone C1(1−) (CHEBI:192557) |
| Incoming Relation(s) |
| asterriquinone C1(1−) (CHEBI:192557) is conjugate base of asterriquinone C1 (CHEBI:192555) |
| IUPAC Name |
|---|
| 2,5-dihydroxy-3-(1H-indol-3-yl)-6-[2-(2-methylbut-3-en-2-yl)-1H-indol-3-yl]cyclohexa-2,5-diene-1,4-dione |
| Synonyms | Source |
|---|---|
| asterriquinone C-1 | ChEBI |
| truncaquinone B | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| CPD-16845 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| CAS:78723-18-9 | ChEBI |
| Citations |
|---|