EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H34O3 |
| Net Charge | 0 |
| Average Mass | 298.467 |
| Monoisotopic Mass | 298.25079 |
| SMILES | CCCCC/C=C\CC(O)CCCCCCCCC(=O)O |
| InChI | InChI=1S/C18H34O3/c1-2-3-4-5-8-11-14-17(19)15-12-9-6-7-10-13-16-18(20)21/h8,11,17,19H,2-7,9-10,12-16H2,1H3,(H,20,21)/b11-8- |
| InChIKey | WVYIZGMCLSGZGG-FLIBITNWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Candida boidinii (ncbitaxon:5477) | - | PubMed (24967938) | |
| Lactiplantibacillus plantarum (ncbitaxon:1590) | - | PubMed (20058923) | Species also known as Lactobacillus plantarum. |
| Mus Musculus (ncbitaxon:10090) | |||
| lung (BTO:0000763) | MetaboLights (MTBLS4590) | Strain: BALB/c [EFO:0000602] | |
| serum (BTO:0001239) | MetaboLights (MTBLS4590) | Strain: BALB/c [EFO:0000602] | |
| colon (BTO:0000269) | MetaboLights (MTBLS4590) | Strain: BALB/c [EFO:0000602] | |
| Stenotrophomonas nitritireducens (ncbitaxon:83617) | - | PubMed (18197675) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (12Z)-10-hydroxyoctadec-12-enoic acid (CHEBI:192538) has role anti-inflammatory agent (CHEBI:67079) |
| (12Z)-10-hydroxyoctadec-12-enoic acid (CHEBI:192538) has role antifungal agent (CHEBI:35718) |
| (12Z)-10-hydroxyoctadec-12-enoic acid (CHEBI:192538) has role bacterial metabolite (CHEBI:76969) |
| (12Z)-10-hydroxyoctadec-12-enoic acid (CHEBI:192538) is a hydroxy monounsaturated fatty acid (CHEBI:131869) |
| (12Z)-10-hydroxyoctadec-12-enoic acid (CHEBI:192538) is a octadecenoic acid (CHEBI:25634) |
| (12Z)-10-hydroxyoctadec-12-enoic acid (CHEBI:192538) is conjugate acid of (12Z)-10-hydroxyoctadec-12-enoate (CHEBI:195300) |
| Incoming Relation(s) |
| (12Z)-10-hydroxyoctadec-12-enoate (CHEBI:195300) is conjugate base of (12Z)-10-hydroxyoctadec-12-enoic acid (CHEBI:192538) |
| IUPAC Name |
|---|
| (12Z)-10-hydroxyoctadec-12-enoic acid |
| Synonyms | Source |
|---|---|
| 10-HOE | ChEBI |
| 10-hydroxy-12Z-octadecenoic acid | LIPID MAPS |
| 10-hydroxy-12(Z)-octadecenoic acid | ChEBI |
| 10-hydroxy-cis-12-octadecenoic acid | ChEBI |
| 12(Z)-10-HOME | LIPID MAPS |
| (12Z)-10-hydroxy-12-octadecenoic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 57451003 | ChemSpider |
| LMFA02000345 | LIPID MAPS |
| Citations |
|---|