EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H8ClO5 |
| Net Charge | -1 |
| Average Mass | 255.633 |
| Monoisotopic Mass | 255.00657 |
| SMILES | C[C@@H]1Cc2c(Cl)cc(C(=O)[O-])c(O)c2C(=O)O1 |
| InChI | InChI=1S/C11H9ClO5/c1-4-2-5-7(12)3-6(10(14)15)9(13)8(5)11(16)17-4/h3-4,13H,2H2,1H3,(H,14,15)/p-1/t4-/m1/s1 |
| InChIKey | OSFWJKYWJMZKSM-SCSAIBSYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ochratoxin α(1−) (CHEBI:192527) is a isochromanes (CHEBI:38762) |
| ochratoxin α(1−) (CHEBI:192527) is a isocoumarins (CHEBI:38758) |
| ochratoxin α(1−) (CHEBI:192527) is a organochlorine compound (CHEBI:36683) |
| ochratoxin α(1−) (CHEBI:192527) is conjugate base of ochratoxin α (CHEBI:133917) |
| Incoming Relation(s) |
| ochratoxin α (CHEBI:133917) is conjugate acid of ochratoxin α(1−) (CHEBI:192527) |
| UniProt Name | Source |
|---|---|
| ochratoxin α | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-22713 | MetaCyc |