EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H9ClO5 |
| Net Charge | 0 |
| Average Mass | 256.641 |
| Monoisotopic Mass | 256.01385 |
| SMILES | C[C@@H]1Cc2c(Cl)cc(C(=O)O)c(O)c2C(=O)O1 |
| InChI | InChI=1S/C11H9ClO5/c1-4-2-5-7(12)3-6(10(14)15)9(13)8(5)11(16)17-4/h3-4,13H,2H2,1H3,(H,14,15)/t4-/m1/s1 |
| InChIKey | OSFWJKYWJMZKSM-SCSAIBSYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Acinetobacter sp. neg1 (ncbitaxon:1561068) | - | PubMed (28119679) | |
| Aspergillus niger (ncbitaxon:5061) | - | PubMed (17653510) | |
| Aspergillus tubingensis (ncbitaxon:5068) | - | PubMed (27558439) | |
| Danio rerio (ncbitaxon:7955) | - | PubMed (26861395) | |
| Homo Sapiens (ncbitaxon:9606) | urine (BTO:0001419) | PubMed (23041474) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | marine xenobiotic metabolite Any metabolite produced by metabolism of a xenobiotic compound in marine macro- and microorganisms. human urinary metabolite Any metabolite (endogenous or exogenous) found in human urine samples. bacterial xenobiotic metabolite Any bacterial metabolite produced by metabolism of a xenobiotic compound in bacteria. human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ochratoxin α (CHEBI:133917) has role bacterial xenobiotic metabolite (CHEBI:76976) |
| ochratoxin α (CHEBI:133917) has role human urinary metabolite (CHEBI:84087) |
| ochratoxin α (CHEBI:133917) has role human xenobiotic metabolite (CHEBI:76967) |
| ochratoxin α (CHEBI:133917) has role marine xenobiotic metabolite (CHEBI:83399) |
| ochratoxin α (CHEBI:133917) is a benzoic acids (CHEBI:22723) |
| ochratoxin α (CHEBI:133917) is a isochromanes (CHEBI:38762) |
| ochratoxin α (CHEBI:133917) is a isocoumarins (CHEBI:38758) |
| ochratoxin α (CHEBI:133917) is a organochlorine compound (CHEBI:36683) |
| ochratoxin α (CHEBI:133917) is a phenols (CHEBI:33853) |
| ochratoxin α (CHEBI:133917) is conjugate acid of ochratoxin α(1−) (CHEBI:192527) |
| Incoming Relation(s) |
| ochratoxin A (CHEBI:7719) has functional parent ochratoxin α (CHEBI:133917) |
| ochratoxin α(1−) (CHEBI:192527) is conjugate base of ochratoxin α (CHEBI:133917) |
| IUPAC Name |
|---|
| (3R)-5-chloro-8-hydroxy-3-methyl-1-oxo-3,4-dihydro-1H-2-benzopyran-7-carboxylic acid |
| Synonyms | Source |
|---|---|
| alpha-Ochratoxin | ChemIDplus |
| (R)-(−)-ochratoxin α | ChEBI |
| (R)-ochratoxin α | ChEBI |
| Ochratoxin alpha | ChemIDplus |
| (−)-ochratoxin α | ChEBI |
| α-ochratoxin | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6125765 | Reaxys |
| CAS:19165-63-0 | ChemIDplus |
| Citations |
|---|