EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H8N2O3 |
| Net Charge | 0 |
| Average Mass | 240.218 |
| Monoisotopic Mass | 240.05349 |
| SMILES | O=C(O)c1cccc2nc3c(O)cccc3nc12 |
| InChI | InChI=1S/C13H8N2O3/c16-10-6-2-5-9-12(10)15-8-4-1-3-7(13(17)18)11(8)14-9/h1-6,16H,(H,17,18) |
| InChIKey | QXWUQPXBVUWEOH-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces sp. (ncbitaxon:193) | - | PubMed (21467685) | Strain: IFM 11204 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-hydroxyphenazine-1-carboxylic acid (CHEBI:192505) has role bacterial metabolite (CHEBI:76969) |
| 6-hydroxyphenazine-1-carboxylic acid (CHEBI:192505) is a aromatic carboxylic acid (CHEBI:33859) |
| 6-hydroxyphenazine-1-carboxylic acid (CHEBI:192505) is a hydroxy monocarboxylic acid (CHEBI:35868) |
| 6-hydroxyphenazine-1-carboxylic acid (CHEBI:192505) is a phenazines (CHEBI:39201) |
| 6-hydroxyphenazine-1-carboxylic acid (CHEBI:192505) is conjugate acid of 6-hydroxyphenazine-1-carboxylate (CHEBI:192496) |
| Incoming Relation(s) |
| 6-hydroxyphenazine-1-carboxylate (CHEBI:192496) is conjugate base of 6-hydroxyphenazine-1-carboxylic acid (CHEBI:192505) |
| IUPAC Name |
|---|
| 6-hydroxyphenazine-1-carboxylic acid |
| Synonym | Source |
|---|---|
| 6-hydroxy-1-phenazinecarboxylic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:29453-77-8 | ChEBI |
| Citations |
|---|