EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H20N3O3 |
| Net Charge | +1 |
| Average Mass | 218.277 |
| Monoisotopic Mass | 218.14992 |
| SMILES | C[C@H]([NH3+])C(=O)N[C@@H](CCCC[NH3+])C(=O)[O-] |
| InChI | InChI=1S/C9H19N3O3/c1-6(11)8(13)12-7(9(14)15)4-2-3-5-10/h6-7H,2-5,10-11H2,1H3,(H,12,13)(H,14,15)/p+1/t6-,7-/m0/s1 |
| InChIKey | QXRNAOYBCYVZCD-BQBZGAKWSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ala-Lys(1+) (CHEBI:192470) is a peptide cation (CHEBI:60194) |
| Ala-Lys(1+) (CHEBI:192470) is conjugate acid of Ala-Lys (CHEBI:132403) |
| Incoming Relation(s) |
| Ala-Lys (CHEBI:132403) is conjugate base of Ala-Lys(1+) (CHEBI:192470) |
| IUPAC Name |
|---|
| (2S)-6-azaniumyl-2-{[(2S)-2-azaniumylpropanoyl]amino}hexanoate |
| Synonyms | Source |
|---|---|
| AK(1+) | ChEBI |
| L-alanyl-L-lysine(1+) | ChEBI |
| L-alanyl-L-lysine cation | ChEBI |
| L-Ala-L-Lys(1+) | ChEBI |
| UniProt Name | Source |
|---|---|
| L-alanyl-L-lysine | UniProt |
| Citations |
|---|