EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H19N3O3 |
| Net Charge | 0 |
| Average Mass | 217.269 |
| Monoisotopic Mass | 217.14264 |
| SMILES | C[C@H](N)C(=O)N[C@@H](CCCCN)C(=O)O |
| InChI | InChI=1S/C9H19N3O3/c1-6(11)8(13)12-7(9(14)15)4-2-3-5-10/h6-7H,2-5,10-11H2,1H3,(H,12,13)(H,14,15)/t6-,7-/m0/s1 |
| InChIKey | QXRNAOYBCYVZCD-BQBZGAKWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Calanus helgolandicus (ncbitaxon:114068) | |||
| - | PubMed (26364855) | ||
| - | MetaboLights (MTBLS91) | ||
| - | MetaboLights (MTBLS91) | From MetaboLights |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ala-Lys (CHEBI:132403) has role marine metabolite (CHEBI:76507) |
| Ala-Lys (CHEBI:132403) is a dipeptide (CHEBI:46761) |
| Ala-Lys (CHEBI:132403) is conjugate base of Ala-Lys(1+) (CHEBI:192470) |
| Incoming Relation(s) |
| Ala-Lys(1+) (CHEBI:192470) is conjugate acid of Ala-Lys (CHEBI:132403) |
| IUPAC Name |
|---|
| L-alanyl-L-lysine |
| Synonyms | Source |
|---|---|
| alanyllysine | ChEBI |
| AK | ChEBI |
| L-Ala-L-Lys | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1727665 | Reaxys |
| CAS:6366-77-4 | ChEBI |
| Citations |
|---|