EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H16N5O13P3 |
| Net Charge | 0 |
| Average Mass | 507.182 |
| Monoisotopic Mass | 506.99575 |
| SMILES | Nc1nc(=O)c2ncn([C@H]3C[C@H](O)[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O3)c2n1 |
| InChI | InChI=1S/C10H16N5O13P3/c11-10-13-8-7(9(17)14-10)12-3-15(8)6-1-4(16)5(26-6)2-25-30(21,22)28-31(23,24)27-29(18,19)20/h3-6,16H,1-2H2,(H,21,22)(H,23,24)(H2,18,19,20)(H3,11,13,14,17)/t4-,5+,6+/m0/s1 |
| InChIKey | HAAZLUGHYHWQIW-KVQBGUIXSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arabidopsis thaliana (ncbitaxon:3702) | - | MetaboLights (MTBLS129) | From MetaboLights |
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) | |
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Mus musculus (ncbitaxon:10090) | |||
| - | PubMed (19425150) | Source: BioModels - MODEL1507180067 | |
| - | MetaboLights (MTBLS225) | From MetaboLights | |
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (7929110) | |
| Solanum lycopersicum (ncbitaxon:4081) | leaf (BTO:0000713) | MetaboLights (MTBLS297) | From MetaboLights |
| Roles Classification |
|---|
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). Arabidopsis thaliana metabolite Any plant metabolite that is produced by Arabidopsis thaliana. Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dGTP (CHEBI:16497) has role Arabidopsis thaliana metabolite (CHEBI:140602) |
| dGTP (CHEBI:16497) has role Escherichia coli metabolite (CHEBI:76971) |
| dGTP (CHEBI:16497) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| dGTP (CHEBI:16497) has role human metabolite (CHEBI:77746) |
| dGTP (CHEBI:16497) has role mouse metabolite (CHEBI:75771) |
| dGTP (CHEBI:16497) has role plant metabolite (CHEBI:76924) |
| dGTP (CHEBI:16497) is a deoxyguanosine phosphate (CHEBI:23625) |
| dGTP (CHEBI:16497) is a guanyl deoxyribonucleotide (CHEBI:63573) |
| dGTP (CHEBI:16497) is a purine 2'-deoxyribonucleoside 5'-triphosphate (CHEBI:37042) |
| dGTP (CHEBI:16497) is conjugate acid of dGTP(3−) (CHEBI:57794) |
| Incoming Relation(s) |
| dGTP(3−) (CHEBI:57794) is conjugate base of dGTP (CHEBI:16497) |
| IUPAC Name |
|---|
| 2'-deoxyguanosine 5'-(tetrahydrogen triphosphate) |
| Synonyms | Source |
|---|---|
| 2'-deoxy-GTP | ChEBI |
| 2'-deoxyguanosine 5'-triphosphate | KEGG COMPOUND |
| 2'-deoxyguanosine triphosphate | ChEBI |
| deoxy-GTP | HMDB |
| deoxyguanosine 5'-triphosphate | KEGG COMPOUND |
| deoxyguanosine triphosphate | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| 58613 | ChemSpider |
| C00019346 | KNApSAcK |
| C00286 | KEGG COMPOUND |
| DB02181 | DrugBank |
| Deoxyguanosine_triphosphate | Wikipedia |
| DGT | PDBeChem |
| ECMDB01440 | ECMDB |
| FDB022623 | FooDB |
| HMDB0001440 | HMDB |
| YMDB00744 | YMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:73481 | Reaxys |
| CAS:2564-35-4 | ChemIDplus |
| Citations |
|---|