EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H10N2O2 |
| Net Charge | 0 |
| Average Mass | 226.235 |
| Monoisotopic Mass | 226.07423 |
| SMILES | COc1cccc2nc3c(O)cccc3nc12 |
| InChI | InChI=1S/C13H10N2O2/c1-17-11-7-3-5-9-13(11)15-8-4-2-6-10(16)12(8)14-9/h2-7,16H,1H3 |
| InChIKey | DUXXRWZHWRRFTL-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Lysobacter antibioticus (ncbitaxon:84531) | - | PubMed (27145204) | Strain: OH13 |
| Nocardiopsis sp. 236 (ncbitaxon:1150770) | - | PubMed (23917857) | |
| Streptomyces thioluteus (ncbitaxon:66431) | - | DOI (10.1021/jo01287a075) |
| Roles Classification |
|---|
| Biological Roles: | marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-hydroxy-6-methoxyphenazine (CHEBI:192366) has role bacterial metabolite (CHEBI:76969) |
| 1-hydroxy-6-methoxyphenazine (CHEBI:192366) has role marine metabolite (CHEBI:76507) |
| 1-hydroxy-6-methoxyphenazine (CHEBI:192366) is a aromatic ether (CHEBI:35618) |
| 1-hydroxy-6-methoxyphenazine (CHEBI:192366) is a organic hydroxy compound (CHEBI:33822) |
| 1-hydroxy-6-methoxyphenazine (CHEBI:192366) is a phenazines (CHEBI:39201) |
| IUPAC Name |
|---|
| 6-methoxyphenazin-1-ol |
| Synonyms | Source |
|---|---|
| 1-methoxy-6-hydroxyphenazine | ChEBI |
| 6-methoxy-1-phenazinol | ChEBI |
| UniProt Name | Source |
|---|---|
| 1-hydroxy-6-methoxyphenazine | UniProt |
| Registry Numbers | Sources |
|---|---|
| CAS:13129-58-3 | ChEBI |
| Citations |
|---|