EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H8N2O2 |
| Net Charge | 0 |
| Average Mass | 212.208 |
| Monoisotopic Mass | 212.05858 |
| SMILES | Oc1cccc2nc3c(O)cccc3nc12 |
| InChI | InChI=1S/C12H8N2O2/c15-9-5-1-3-7-11(9)14-8-4-2-6-10(16)12(8)13-7/h1-6,15-16H |
| InChIKey | JOXNFMAXWAPITK-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Lysobacter antibioticus (ncbitaxon:84531) | - | PubMed (27145204) | Strain: OH13 |
| Nannocystis pusilla (ncbitaxon:889268) | - | PubMed (24460410) | Strain: Ari7 |
| Nocardiopsis sp. 13-12-13 (ncbitaxon:1570773) | - | PubMed (25820602) | |
| Nocardiopsis sp. 13-33-15 (ncbitaxon:1570777) | - | PubMed (25820602) | |
| Nonomuraea sp. ATCC 55076 (ncbitaxon:1909395) | - | PubMed (28626548) | |
| Streptomyces sp. SpC080624SC-11 (ncbitaxon:663935) | - | PubMed (24892559) | |
| Streptomyces thioluteus (ncbitaxon:66431) | - | DOI (10.11554/antibioticsa.12.1_17) | Strain: M 6-62 n |
| Streptosporangium sp. (ncbitaxon:47486) | - | PubMed (6501107) |
| Roles Classification |
|---|
| Biological Roles: | biological pigment An endogenous molecular entity that results in a colour of an organism as the consequence of the selective absorption of light. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1,6-dihydroxyphenazine (CHEBI:192365) has role bacterial metabolite (CHEBI:76969) |
| 1,6-dihydroxyphenazine (CHEBI:192365) has role biological pigment (CHEBI:26130) |
| 1,6-dihydroxyphenazine (CHEBI:192365) has role marine metabolite (CHEBI:76507) |
| 1,6-dihydroxyphenazine (CHEBI:192365) is a diol (CHEBI:23824) |
| 1,6-dihydroxyphenazine (CHEBI:192365) is a phenazines (CHEBI:39201) |
| Incoming Relation(s) |
| 1,6-dihydroxyphenazine N5-oxide (CHEBI:192384) has functional parent 1,6-dihydroxyphenazine (CHEBI:192365) |
| 1,6-dimethoxyphenazine (CHEBI:192367) has functional parent 1,6-dihydroxyphenazine (CHEBI:192365) |
| IUPAC Name |
|---|
| phenazine-1,6-diol |
| Synonyms | Source |
|---|---|
| 1,6-phenazinediol | ChemIDplus |
| crystalloiodinine B | ChEBI |
| UniProt Name | Source |
|---|---|
| 1,6-dihydroxyphenazine | UniProt |
| Citations |
|---|