EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H9O2 |
| Net Charge | -1 |
| Average Mass | 113.136 |
| Monoisotopic Mass | 113.06080 |
| SMILES | CC/C=C(\C)C(=O)[O-] |
| InChI | InChI=1S/C6H10O2/c1-3-4-5(2)6(7)8/h4H,3H2,1-2H3,(H,7,8)/p-1/b5-4+ |
| InChIKey | JJYWRQLLQAKNAD-SNAWJCMRSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-methyl-(2E)-pentenoate(1−) (CHEBI:192252) has functional parent propionate (CHEBI:17272) |
| 2-methyl-(2E)-pentenoate(1−) (CHEBI:192252) is a methyl-branched fatty acid anion (CHEBI:67013) |
| 2-methyl-(2E)-pentenoate(1−) (CHEBI:192252) is conjugate base of 2-Methyl-2-pentenoic acid (CHEBI:173385) |
| Incoming Relation(s) |
| 2-Methyl-2-pentenoic acid (CHEBI:173385) is conjugate acid of 2-methyl-(2E)-pentenoate(1−) (CHEBI:192252) |
| Synonym | Source |
|---|---|
| trans-2-methyl-2-pentenoate(1−) | SUBMITTER |
| UniProt Name | Source |
|---|---|
| 2-methyl-(2E)-pentenoate | UniProt |
| Citations |
|---|