EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:173385 - 2-Methyl-2-pentenoic acid
| Formula | C6H10O2 |
| Net Charge | 0 |
| Average Mass | 114.144 |
| Monoisotopic Mass | 114.06808 |
| SMILES | CC/C=C(\C)C(=O)O |
| InChI | InChI=1S/C6H10O2/c1-3-4-5(2)6(7)8/h4H,3H2,1-2H3,(H,7,8)/b5-4+ |
| InChIKey | JJYWRQLLQAKNAD-SNAWJCMRSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-Methyl-2-pentenoic acid (CHEBI:173385) is a methyl-branched fatty acid (CHEBI:62499) |
| 2-Methyl-2-pentenoic acid (CHEBI:173385) is conjugate acid of 2-methyl-(2E)-pentenoate(1−) (CHEBI:192252) |
| Incoming Relation(s) |
| 2-methyl-(2E)-pentenoate(1−) (CHEBI:192252) is conjugate base of 2-Methyl-2-pentenoic acid (CHEBI:173385) |
| IUPAC Name |
|---|
| (E)-2-methylpent-2-enoic acid |