EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H12ClN3O2S2 |
| Net Charge | 0 |
| Average Mass | 377.878 |
| Monoisotopic Mass | 377.00595 |
| SMILES | Cn1c2[n+](c([O-])c(-c3ccccc3)c1=O)[C@@H](c1cnc(Cl)s1)CS2 |
| InChI | InChI=1S/C16H12ClN3O2S2/c1-19-13(21)12(9-5-3-2-4-6-9)14(22)20-10(8-23-16(19)20)11-7-18-15(17)24-11/h2-7,10H,8H2,1H3/t10-/m1/s1 |
| InChIKey | YGDKLOWGWUOTRD-SNVBAGLBSA-N |
| Roles Classification |
|---|
| Applications: | insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fenmezoditiaz (CHEBI:192083) is a 1,3-thiazoles (CHEBI:38418) |
| fenmezoditiaz (CHEBI:192083) is a benzenes (CHEBI:22712) |
| fenmezoditiaz (CHEBI:192083) is a iminium betaine (CHEBI:35285) |
| fenmezoditiaz (CHEBI:192083) is a organochlorine insecticide (CHEBI:25705) |
| fenmezoditiaz (CHEBI:192083) is a thiazolopyrimidine (CHEBI:64196) |
| IUPAC Name |
|---|
| (3R)-3-(2-chloro-1,3-thiazol-5-yl)-8-methyl-7-oxo-6-phenyl-2,3,7,8-tetrahydro[1,3]thiazolo[3,2-a]pyrimidin-4-ium-5-olate |
| Synonym | Source |
|---|---|
| (3R)-3-(2-chlorothiazol-5-yl)-8-methyl-7-oxo-6-phenyl-2,3,7,8-tetrahydro[1,3]thiazolo[3,2-a]pyrimidin-4-ium-5-olate | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 109120574 | ChemSpider |
| 3363 | PPDB |
| fenmezoditiaz | Alan Wood's Pesticides |
| WO2020058010 | Patent |
| Registry Numbers | Sources |
|---|---|
| CAS:2413390-32-4 | ChemIDplus |