EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H8D3NO2S |
| Net Charge | 0 |
| Average Mass | 152.233 |
| Monoisotopic Mass | 152.06988 |
| SMILES | [2H]C([2H])([2H])SCC[C@H](N)C(=O)O |
| InChI | InChI=1S/C5H11NO2S/c1-9-3-2-4(6)5(7)8/h4H,2-3,6H2,1H3,(H,7,8)/t4-/m0/s1/i1D3 |
| InChIKey | FFEARJCKVFRZRR-OSIBIXDNSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). micronutrient Any nutrient required in small quantities by organisms throughout their life in order to orchestrate a range of physiological functions. algal metabolite Any eukaryotic metabolite produced during a metabolic reaction in algae including unicellular organisms like chlorella and diatoms to multicellular organisms like giant kelps and brown algae. Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). Daphnia magna metabolite A Daphnia metabolite produced by the species Daphnia magna. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. algal metabolite Any eukaryotic metabolite produced during a metabolic reaction in algae including unicellular organisms like chlorella and diatoms to multicellular organisms like giant kelps and brown algae. Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). Daphnia magna metabolite A Daphnia metabolite produced by the species Daphnia magna. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. |
| Applications: | nutraceutical A product in capsule, tablet or liquid form that provide essential nutrients, such as a vitamin, an essential mineral, a protein, an herb, or similar nutritional substance. antidote to paracetamol poisoning A role borne by a molecule that acts to counteract or neutralize the deleterious effects of paracetamol (acetaminophen). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-methionine-d3 (CHEBI:192080) is a L-methionine (CHEBI:16643) |
| L-methionine-d3 (CHEBI:192080) is a deuterated compound (CHEBI:76107) |