EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H4D5NO4 |
| Net Charge | 0 |
| Average Mass | 152.161 |
| Monoisotopic Mass | 152.08454 |
| SMILES | [2H]C([2H])(C(=O)O)C([2H])([2H])[C@]([2H])(N)C(=O)O |
| InChI | InChI=1S/C5H9NO4/c6-3(5(9)10)1-2-4(7)8/h3H,1-2,6H2,(H,7,8)(H,9,10)/t3-/m0/s1/i1D2,2D2,3D |
| InChIKey | WHUUTDBJXJRKMK-NKXUJHECSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | micronutrient Any nutrient required in small quantities by organisms throughout their life in order to orchestrate a range of physiological functions. Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. ferroptosis inducer Any substance that induces or promotes ferroptosis (a type of programmed cell death dependent on iron and characterized by the accumulation of lipid peroxides) in organisms. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). neurotransmitter An endogenous compound that is used to transmit information across the synapse between a neuron and another cell. fundamental metabolite Any metabolite produced by all living cells. fundamental metabolite Any metabolite produced by all living cells. |
| Application: | nutraceutical A product in capsule, tablet or liquid form that provide essential nutrients, such as a vitamin, an essential mineral, a protein, an herb, or similar nutritional substance. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-glutamic acid-d5 (CHEBI:192079) is a L-glutamic acid (CHEBI:16015) |
| L-glutamic acid-d5 (CHEBI:192079) is a deuterated compound (CHEBI:76107) |