EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | [13C2]H5O2 |
| Net Charge | 0 |
| Average Mass | 78.045 |
| Monoisotopic Mass | 78.03577 |
| SMILES | [15NH2][13CH2][13C](=O)O |
| InChI | InChI=1S/C2H5NO2/c3-1-2(4)5/h1,3H2,(H,4,5)/i1+1,2+1,3+1 |
| InChIKey | DHMQDGOQFOQNFH-VMIGTVKRSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | neurotransmitter An endogenous compound that is used to transmit information across the synapse between a neuron and another cell. fundamental metabolite Any metabolite produced by all living cells. NMDA receptor agonist An excitatory amino acid agonist which binds to NMDA receptors and triggers a response. micronutrient Any nutrient required in small quantities by organisms throughout their life in order to orchestrate a range of physiological functions. EC 2.1.2.1 (glycine hydroxymethyltransferase) inhibitor An EC 2.1.2.* (hydroxymethyl-, formyl- and related transferases) inhibitor that interferes with the action of glycine hydroxymethyltransferase (EC 2.1.2.1). |
| Applications: | hepatoprotective agent Any compound that is able to prevent damage to the liver. nutraceutical A product in capsule, tablet or liquid form that provide essential nutrients, such as a vitamin, an essential mineral, a protein, an herb, or similar nutritional substance. NMDA receptor agonist An excitatory amino acid agonist which binds to NMDA receptors and triggers a response. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| glycine-13C2,15N (CHEBI:191950) is a 13C-modified compound (CHEBI:139357) |
| glycine-13C2,15N (CHEBI:191950) is a 15N-modified compound (CHEBI:139360) |
| glycine-13C2,15N (CHEBI:191950) is a glycine (CHEBI:15428) |
| Synonym | Source |
|---|---|
| Gly-13C2-15N | SUBMITTER |