EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H44O3 |
| Net Charge | 0 |
| Average Mass | 416.646 |
| Monoisotopic Mass | 416.32905 |
| SMILES | [H][C@@]12CC=C3C[C@@H](O)CC[C@]3(C)[C@@]1([H])CC[C@@]1(C)[C@@]2([H])C[C@]2([H])O[C@](O)(CCC(C)C)[C@@H](C)[C@]12[H] |
| InChI | InChI=1S/C27H44O3/c1-16(2)8-13-27(29)17(3)24-23(30-27)15-22-20-7-6-18-14-19(28)9-11-25(18,4)21(20)10-12-26(22,24)5/h6,16-17,19-24,28-29H,7-15H2,1-5H3/t17-,19-,20+,21-,22-,23-,24-,25-,26-,27+/m0/s1 |
| InChIKey | SWULDWSDBMQXRY-GQPIHPSPSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (22R)-furost-5-en-3β,22-diol (CHEBI:191946) has functional parent (16S)-hydroxy-22-oxocholesterol (CHEBI:191941) |
| (22R)-furost-5-en-3β,22-diol (CHEBI:191946) has parent hydride furostan (CHEBI:24130) |
| (22R)-furost-5-en-3β,22-diol (CHEBI:191946) has role plant metabolite (CHEBI:76924) |
| (22R)-furost-5-en-3β,22-diol (CHEBI:191946) is a 3β-hydroxy-Δ5-steroid (CHEBI:1722) |
| (22R)-furost-5-en-3β,22-diol (CHEBI:191946) is a 3β-sterol (CHEBI:35348) |
| (22R)-furost-5-en-3β,22-diol (CHEBI:191946) is a C27-steroid (CHEBI:131619) |
| IUPAC Name |
|---|
| (22R)-furost-5-en-3β,22-diol |
| UniProt Name | Source |
|---|---|
| (22R)-furost-5-en-3β-22-diol | UniProt |
| Citations |
|---|