EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H44O3 |
| Net Charge | 0 |
| Average Mass | 416.646 |
| Monoisotopic Mass | 416.32905 |
| SMILES | [H][C@]1([C@H](C)C(=O)CCC(C)C)[C@@H](O)C[C@@]2([H])[C@]3([H])CC=C4C[C@@H](O)CC[C@]4(C)[C@@]3([H])CC[C@]12C |
| InChI | InChI=1S/C27H44O3/c1-16(2)6-9-23(29)17(3)25-24(30)15-22-20-8-7-18-14-19(28)10-12-26(18,4)21(20)11-13-27(22,25)5/h7,16-17,19-22,24-25,28,30H,6,8-15H2,1-5H3/t17-,19+,20-,21+,22+,24+,25+,26+,27+/m1/s1 |
| InChIKey | VTNZQXZPUYPXFT-AHWSEQNHSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (16S)-hydroxy-22-oxocholesterol (CHEBI:191941) has functional parent (16S,22S)-dihydroxycholesterol (CHEBI:191938) |
| (16S)-hydroxy-22-oxocholesterol (CHEBI:191941) has role plant metabolite (CHEBI:76924) |
| (16S)-hydroxy-22-oxocholesterol (CHEBI:191941) is a 16β-hydroxy steroid (CHEBI:17354) |
| (16S)-hydroxy-22-oxocholesterol (CHEBI:191941) is a 3β-hydroxy-Δ5-steroid (CHEBI:1722) |
| (16S)-hydroxy-22-oxocholesterol (CHEBI:191941) is a 3β-sterol (CHEBI:35348) |
| (16S)-hydroxy-22-oxocholesterol (CHEBI:191941) is a C27-steroid (CHEBI:131619) |
| (16S)-hydroxy-22-oxocholesterol (CHEBI:191941) is a cholestanoid (CHEBI:50401) |
| Incoming Relation(s) |
| (22R)-furost-5-en-3β,22-diol (CHEBI:191946) has functional parent (16S)-hydroxy-22-oxocholesterol (CHEBI:191941) |
| IUPAC Name |
|---|
| 3β,16β-dihydroxycholest-5-en-22-one |
| Synonyms | Source |
|---|---|
| (S)-16-hydroxy-22-ketocholesterol | SUBMITTER |
| (S)-16-hydroxy-22-oxocholesterol | SUBMITTER |
| UniProt Name | Source |
|---|---|
| (16S)-hydroxy-22-oxocholesterol | UniProt |
| Citations |
|---|