EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H19Cl2F4N3O4 |
| Net Charge | 0 |
| Average Mass | 548.320 |
| Monoisotopic Mass | 547.06887 |
| SMILES | CCN1OCC(NC(=O)c2ccc(C3=NOC(c4cc(Cl)c(F)c(Cl)c4)(C(F)(F)F)C3)cc2C)C1=O |
| InChI | InChI=1S/C23H19Cl2F4N3O4/c1-3-32-21(34)18(10-35-32)30-20(33)14-5-4-12(6-11(14)2)17-9-22(36-31-17,23(27,28)29)13-7-15(24)19(26)16(25)8-13/h4-8,18H,3,9-10H2,1-2H3,(H,30,33) |
| InChIKey | WLSQDEYDCAGPIR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | |
| Applications: | insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. acaricide A substance used to destroy pests of the subclass Acari (mites and ticks). agrochemical An agrochemical is a substance that is used in agriculture or horticulture. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isocycloseram (CHEBI:191373) has part (4R,5R)-isocycloseram (CHEBI:191375) |
| isocycloseram (CHEBI:191373) has part (4R,5S)-isocycloseram (CHEBI:191374) |
| isocycloseram (CHEBI:191373) has part (4S,5R)-isocycloseram (CHEBI:191376) |
| isocycloseram (CHEBI:191373) has part (4S,5S)-isocycloseram (CHEBI:191377) |
| isocycloseram (CHEBI:191373) has role acaricide (CHEBI:22153) |
| isocycloseram (CHEBI:191373) has role agrochemical (CHEBI:33286) |
| isocycloseram (CHEBI:191373) has role GABA-gated chloride channel antagonist (CHEBI:38999) |
| isocycloseram (CHEBI:191373) has role insecticide (CHEBI:24852) |
| isocycloseram (CHEBI:191373) is a diastereoisomeric mixture (CHEBI:60915) |
| Synonym | Source |
|---|---|
| mixture comprised of 80-100% 4-[(5S)-5-(3,5-dichloro-4-fluorophenyl)-5-(trifluoromethyl)-4,5-dihydro-1,2-oxazol-3-yl]-N-[(4R)-2-ethyl-3-oxo-1,2-oxazolidin-4-yl]-2-methylbenzamide and 20-0% of the (5R,4R), (5R,4S) and (5S,4S) isomers | Alan Wood's Pesticides |
| Brand Name | Source |
|---|---|
| Plinazolin | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 3194 | PPDB |
| isocycloseram | Alan Wood's Pesticides |
| Registry Numbers | Sources |
|---|---|
| CAS:2061933-85-3 | ChemIDplus |
| Citations |
|---|