EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H26N4O3S |
| Net Charge | 0 |
| Average Mass | 318.443 |
| Monoisotopic Mass | 318.17256 |
| SMILES | CSCC[C@H](NC(=O)[C@H](CC(C)C)NC(=O)CN)C(N)=O |
| InChI | InChI=1S/C13H26N4O3S/c1-8(2)6-10(16-11(18)7-14)13(20)17-9(12(15)19)4-5-21-3/h8-10H,4-7,14H2,1-3H3,(H2,15,19)(H,16,18)(H,17,20)/t9-,10-/m0/s1 |
| InChIKey | RLXSTJVYBMNHEP-UWVGGRQHSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Gly-L-Leu-L-Met-NH2 (CHEBI:191172) has functional parent L-leucine (CHEBI:15603) |
| Gly-L-Leu-L-Met-NH2 (CHEBI:191172) has functional parent L-methioninamide (CHEBI:21362) |
| Gly-L-Leu-L-Met-NH2 (CHEBI:191172) has functional parent glycine (CHEBI:15428) |
| Gly-L-Leu-L-Met-NH2 (CHEBI:191172) is a tripeptide (CHEBI:47923) |
| Gly-L-Leu-L-Met-NH2 (CHEBI:191172) is conjugate base of Gly-L-Leu-L-Met-NH2(1+) (CHEBI:190699) |
| Incoming Relation(s) |
| Gly-L-Leu-L-Met-NH2(1+) (CHEBI:190699) is conjugate acid of Gly-L-Leu-L-Met-NH2 (CHEBI:191172) |
| IUPAC Name |
|---|
| glycyl-L-leucyl-L-methioninamide |
| Synonyms | Source |
|---|---|
| Gly-Leu-Met-NH2 | ChEBI |
| H-Gly-Leu-Met-NH2 | ChEBI |
| GLM-NH2 | ChEBI |
| substance P (9-11) | ChEBI |
| glycyl-leucyl-methioninamide | ChEBI |
| substance P tripeptide (9-11) | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 5384321 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:4652-64-6 | ChEBI |
| Citations |
|---|