EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H32N5O9 |
| Net Charge | -1 |
| Average Mass | 486.502 |
| Monoisotopic Mass | 486.22055 |
| SMILES | CC(=O)N[C@@H](CO)C(=O)N[C@@H](CC(=O)[O-])C(=O)N[C@@H](CCCC[NH3+])C(=O)N1CCC[C@H]1C(=O)[O-] |
| InChI | InChI=1S/C20H33N5O9/c1-11(27)22-14(10-26)18(31)24-13(9-16(28)29)17(30)23-12(5-2-3-7-21)19(32)25-8-4-6-15(25)20(33)34/h12-15,26H,2-10,21H2,1H3,(H,22,27)(H,23,30)(H,24,31)(H,28,29)(H,33,34)/p-1/t12-,13-,14-,15-/m0/s1 |
| InChIKey | HJDRXEQUFWLOGJ-AJNGGQMLSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| goralatide(1−) (CHEBI:190701) is a peptide anion (CHEBI:60334) |
| goralatide(1−) (CHEBI:190701) is conjugate base of goralatide (CHEBI:191178) |
| Incoming Relation(s) |
| goralatide (CHEBI:191178) is conjugate acid of goralatide(1−) (CHEBI:190701) |
| IUPAC Name |
|---|
| (2S)-1-(N-{(2S)-2-[(N-acetyl-L-seryl)amino]-3-carboxylatopropanoyl}-6-azaniumyl-L-norleucyl)pyrrolidine-2-carboxylate |
| Synonyms | Source |
|---|---|
| Ac-SDKP(1−) | ChEBI |
| AcSDKP(1−) | ChEBI |
| Ac-Ser-Asp-Lys-Pro(1−) | ChEBI |
| N-acetyl-Ser-Asp-Lys-Pro(1−) | ChEBI |
| N-acetyl-L-Ser-L-Asp-L-Lys-L-Pro(1−) | ChEBI |
| N-acetyl-L-seryl-L-aspartyl-L-lysyl-L-proline(1−) | ChEBI |
| UniProt Name | Source |
|---|---|
| goralatide | UniProt |
| Citations |
|---|