EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H9ClN2O3S |
| Net Charge | 0 |
| Average Mass | 284.724 |
| Monoisotopic Mass | 284.00224 |
| SMILES | Cc1csc(C(=O)NNC(=O)c2ccco2)c1Cl |
| InChI | InChI=1S/C11H9ClN2O3S/c1-6-5-18-9(8(6)12)11(16)14-13-10(15)7-3-2-4-17-7/h2-5H,1H3,(H,13,15)(H,14,16) |
| InChIKey | XUQFNTTWSLRUJI-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rattus norvegicus (ncbitaxon:10116) | liver (BTO:0000759) | MetaboLights (MTBLS4163) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N'2-(2-furylcarbonyl)-3-chloro-4-methylthiophene-2-carbohydrazide (CHEBI:190554) is a furoic acid (CHEBI:36055) |
| IUPAC Name |
|---|
| N'-(3-chloro-4-methylthiophene-2-carbonyl)uran-2-carbohydrazide |
| Manual Xrefs | Databases |
|---|---|
| 2086418 | ChemSpider |