EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H25ClN2O4S |
| Net Charge | 0 |
| Average Mass | 436.961 |
| Monoisotopic Mass | 436.12236 |
| SMILES | CN1c2ccccc2[C@@H](NCCCCCCC(=O)O)c2ccc(Cl)cc2S1(=O)=O |
| InChI | InChI=1S/C21H25ClN2O4S/c1-24-18-9-6-5-8-16(18)21(23-13-7-3-2-4-10-20(25)26)17-12-11-15(22)14-19(17)29(24,27)28/h5-6,8-9,11-12,14,21,23H,2-4,7,10,13H2,1H3,(H,25,26)/t21-/m1/s1 |
| InChIKey | JICJBGPOMZQUBB-OAQYLSRUSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-tianeptine (CHEBI:190007) is a 7-[(3-chloro-6-methyl-5,5-dioxido-6,11-dihydrodibenzo[c,f][1,2]thiazepin-11-yl)amino]heptanoic acid (CHEBI:190008) |
| (R)-tianeptine (CHEBI:190007) is enantiomer of (S)-tianeptine (CHEBI:190006) |
| Incoming Relation(s) |
| tianeptine (CHEBI:91749) has part (R)-tianeptine (CHEBI:190007) |
| (S)-tianeptine (CHEBI:190006) is enantiomer of (R)-tianeptine (CHEBI:190007) |
| IUPAC Name |
|---|
| 7-{[(11R)-3-chloro-6-methyl-5,5-dioxido-6,11-dihydrodibenzo[c,f][1,2]thiazepin-11-yl]amino}heptanoic acid |
| Citations |
|---|