EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H12N2O2 |
| Net Charge | 0 |
| Average Mass | 180.207 |
| Monoisotopic Mass | 180.08988 |
| SMILES | NCCCC(=O)c1ccc(O)nc1 |
| InChI | InChI=1S/C9H12N2O2/c10-5-1-2-8(12)7-3-4-9(13)11-6-7/h3-4,6H,1-2,5,10H2,(H,11,13) |
| InChIKey | SMMJSMSUOYDEIU-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arthrobacter sp. (ncbitaxon:1667) | - | PubMed (33131868) | Strain: NOR5 |
| Shinella sp. HZN7 (ncbitaxon:879274) | - | PubMed (27568381) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | bacterial xenobiotic metabolite Any bacterial metabolite produced by metabolism of a xenobiotic compound in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-hydroxy-pseudooxy-nornicotine (CHEBI:189824) has role bacterial xenobiotic metabolite (CHEBI:76976) |
| 6-hydroxy-pseudooxy-nornicotine (CHEBI:189824) is a aromatic ketone (CHEBI:76224) |
| 6-hydroxy-pseudooxy-nornicotine (CHEBI:189824) is a hydroxypyridine (CHEBI:24745) |
| 6-hydroxy-pseudooxy-nornicotine (CHEBI:189824) is a primary amino compound (CHEBI:50994) |
| 6-hydroxy-pseudooxy-nornicotine (CHEBI:189824) is conjugate base of 6-hydroxy-pseudooxy-nornicotinium (CHEBI:189663) |
| Incoming Relation(s) |
| 6-hydroxy-pseudooxy-nornicotinium (CHEBI:189663) is conjugate acid of 6-hydroxy-pseudooxy-nornicotine (CHEBI:189824) |
| IUPAC Name |
|---|
| 4-amino-1-(6-hydroxypyridin-3-yl)butan-1-one |
| Synonyms | Source |
|---|---|
| 3-(4-aminobutanoyl)pyridine-6-ol | ChEBI |
| 6HPONor | ChEBI |
| 6-hydroxypseudooxynornicotine | ChEBI |
| 6-OH-pseudooxy-nornicotine | ChEBI |
| Citations |
|---|