EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H13N2O2 |
| Net Charge | +1 |
| Average Mass | 181.215 |
| Monoisotopic Mass | 181.09715 |
| SMILES | [NH3+]CCCC(=O)c1ccc(O)nc1 |
| InChI | InChI=1S/C9H12N2O2/c10-5-1-2-8(12)7-3-4-9(13)11-6-7/h3-4,6H,1-2,5,10H2,(H,11,13)/p+1 |
| InChIKey | SMMJSMSUOYDEIU-UHFFFAOYSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-hydroxy-pseudooxy-nornicotinium (CHEBI:189663) is a primary ammonium ion (CHEBI:65296) |
| 6-hydroxy-pseudooxy-nornicotinium (CHEBI:189663) is conjugate acid of 6-hydroxy-pseudooxy-nornicotine (CHEBI:189824) |
| Incoming Relation(s) |
| 6-hydroxy-pseudooxy-nornicotine (CHEBI:189824) is conjugate base of 6-hydroxy-pseudooxy-nornicotinium (CHEBI:189663) |
| IUPAC Name |
|---|
| 4-(6-hydroxypyridin-3-yl)-4-oxobutan-1-aminium |
| Synonyms | Source |
|---|---|
| 6HPONor(1+) | SUBMITTER |
| 6-hydroxypseudooxynornicotinium | ChEBI |
| UniProt Name | Source |
|---|---|
| 6-hydroxypseudooxynornicotine | UniProt |
| Citations |
|---|