EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H48O3 |
| Net Charge | 0 |
| Average Mass | 456.711 |
| Monoisotopic Mass | 456.36035 |
| SMILES | [H][C@]12C=C[C@]34OC[C@@]5(CCC(C)(C)C[C@]53[H])[C@@H](O)C[C@@]4(C)[C@]1(C)CC[C@@]1([H])C(C)(C)[C@@H](O)CC[C@]21C |
| InChI | InChI=1S/C30H48O3/c1-24(2)14-15-29-18-33-30(21(29)16-24)13-9-20-26(5)11-10-22(31)25(3,4)19(26)8-12-27(20,6)28(30,7)17-23(29)32/h9,13,19-23,31-32H,8,10-12,14-18H2,1-7H3/t19-,20+,21+,22-,23-,26-,27+,28-,29+,30-/m0/s1 |
| InChIKey | IUXCCCANLLMMGX-KTLSIJAESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bupleurum bicaule (ncbitaxon:948041) | Root (BTO:0001188) | PubMed (24863358) | |
| Bupleurum falcatum (ncbitaxon:46367) | - | DOI (10.1016/S0040-4039(00)72932-7) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. rat metabolite Any mammalian metabolite produced during a metabolic reaction in rat (Rattus norvegicus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| saikogenin E (CHEBI:189821) has parent hydride oleanane (CHEBI:36481) |
| saikogenin E (CHEBI:189821) has role plant metabolite (CHEBI:76924) |
| saikogenin E (CHEBI:189821) has role rat metabolite (CHEBI:86264) |
| saikogenin E (CHEBI:189821) is a bridged compound (CHEBI:35990) |
| saikogenin E (CHEBI:189821) is a cyclic ether (CHEBI:37407) |
| saikogenin E (CHEBI:189821) is a diol (CHEBI:23824) |
| saikogenin E (CHEBI:189821) is a hexacyclic triterpenoid (CHEBI:70994) |
| Incoming Relation(s) |
| saikosaponin C (CHEBI:189704) has functional parent saikogenin E (CHEBI:189821) |
| IUPAC Name |
|---|
| 13,28-epoxyolean-11-ene-3β,16β-diol |
| Manual Xrefs | Databases |
|---|---|
| 10217499 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:13715-23-6 | ChEBI |
| Citations |
|---|