EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C48H78O17 |
| Net Charge | 0 |
| Average Mass | 927.135 |
| Monoisotopic Mass | 926.52390 |
| SMILES | [H][C@]12C=C[C@]34OC[C@@]5(CCC(C)(C)C[C@]53[H])[C@@H](O)C[C@@]4(C)[C@]1(C)CC[C@@]1([H])C(C)(C)[C@@H](O[C@@H]3O[C@H](CO[C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)[C@@H](O[C@@H]4O[C@@H](C)[C@H](O)[C@@H](O)[C@H]4O)[C@H](O)[C@H]3O)CC[C@]21C |
| InChI | InChI=1S/C48H78O17/c1-22-30(51)32(53)36(57)40(61-22)65-38-24(20-59-39-35(56)33(54)31(52)23(19-49)62-39)63-41(37(58)34(38)55)64-29-11-12-44(6)25(43(29,4)5)9-13-45(7)26(44)10-14-48-27-17-42(2,3)15-16-47(27,21-60-48)28(50)18-46(45,48)8/h10,14,22-41,49-58H,9,11-13,15-21H2,1-8H3/t22-,23+,24+,25-,26+,27+,28-,29-,30-,31+,32+,33-,34+,35+,36+,37+,38+,39+,40-,41-,44-,45+,46-,47+,48-/m0/s1 |
| InChIKey | VJEMOEYSQDKAQF-JDRYWMLESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bupleurum chinense (ncbitaxon:52451) | |||
| Root (BTO:0001188) | PubMed (26259802) | ||
| - | PubMed (33359917) | ||
| Bupleurum falcatum (ncbitaxon:46367) | fruit (BTO:0000486) | PubMed (10389276) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. anti-HBV agent An antiviral agent that destroys or inhibits the replication of the hepatitis B virus. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| saikosaponin C (CHEBI:189704) has functional parent saikogenin E (CHEBI:189821) |
| saikosaponin C (CHEBI:189704) has role anti-HBV agent (CHEBI:64951) |
| saikosaponin C (CHEBI:189704) has role plant metabolite (CHEBI:76924) |
| saikosaponin C (CHEBI:189704) is a bridged compound (CHEBI:35990) |
| saikosaponin C (CHEBI:189704) is a cyclic ether (CHEBI:37407) |
| saikosaponin C (CHEBI:189704) is a hexacyclic triterpenoid (CHEBI:70994) |
| saikosaponin C (CHEBI:189704) is a saikosaponin (CHEBI:189705) |
| saikosaponin C (CHEBI:189704) is a trisaccharide derivative (CHEBI:63571) |
| IUPAC Name |
|---|
| 16β-hydroxy-13,28-epoxyolean-11-en-3β-yl 6-deoxy-α-L-mannopyranosyl-(1→4)-[β-D-glucopyranosyl-(1→6)]-β-D-glucopyranoside |
| Synonyms | Source |
|---|---|
| (3β,16β)-13,28-epoxy-16-hydroxyolean-11-en-3-yl O-6-deoxy-α-L-mannopyranosyl-(1→4)-O-[β-D-glucopyranosyl-(1→6)]-β-D-glucopyranoside | ChEBI |
| saikosaponin-C | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:20736-08-7 | ChemIDplus |
| Citations |
|---|