EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C48H78O17 |
| Net Charge | 0 |
| Average Mass | 927.135 |
| Monoisotopic Mass | 926.52390 |
| SMILES | [H][C@]12C=C[C@]34OC[C@@]5(CCC(C)(C)C[C@]53[H])[C@@H](O)C[C@@]4(C)[C@]1(C)CC[C@@]1([H])C(C)(C)[C@@H](O[C@@H]3O[C@H](CO[C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)[C@@H](O[C@@H]4O[C@@H](C)[C@H](O)[C@@H](O)[C@H]4O)[C@H](O)[C@H]3O)CC[C@]21C |
| InChI | InChI=1S/C48H78O17/c1-22-30(51)32(53)36(57)40(61-22)65-38-24(20-59-39-35(56)33(54)31(52)23(19-49)62-39)63-41(37(58)34(38)55)64-29-11-12-44(6)25(43(29,4)5)9-13-45(7)26(44)10-14-48-27-17-42(2,3)15-16-47(27,21-60-48)28(50)18-46(45,48)8/h10,14,22-41,49-58H,9,11-13,15-21H2,1-8H3/t22-,23+,24+,25-,26+,27+,28-,29-,30-,31+,32+,33-,34+,35+,36+,37+,38+,39+,40-,41-,44-,45+,46-,47+,48-/m0/s1 |
| InChIKey | VJEMOEYSQDKAQF-JDRYWMLESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bupleurum chinense (ncbitaxon:52451) | |||
| Root (BTO:0001188) | PubMed (26259802) | ||
| - | PubMed (33359917) | ||
| Bupleurum falcatum (ncbitaxon:46367) | fruit (BTO:0000486) | PubMed (10389276) |
| Roles Classification |
|---|
| Biological Roles: | anti-HBV agent An antiviral agent that destroys or inhibits the replication of the hepatitis B virus. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| saikosaponin C (CHEBI:189704) has functional parent saikogenin E (CHEBI:189821) |
| saikosaponin C (CHEBI:189704) has role anti-HBV agent (CHEBI:64951) |
| saikosaponin C (CHEBI:189704) has role plant metabolite (CHEBI:76924) |
| saikosaponin C (CHEBI:189704) is a bridged compound (CHEBI:35990) |
| saikosaponin C (CHEBI:189704) is a cyclic ether (CHEBI:37407) |
| saikosaponin C (CHEBI:189704) is a hexacyclic triterpenoid (CHEBI:70994) |
| saikosaponin C (CHEBI:189704) is a saikosaponin (CHEBI:189705) |
| saikosaponin C (CHEBI:189704) is a trisaccharide derivative (CHEBI:63571) |
| IUPAC Name |
|---|
| 16β-hydroxy-13,28-epoxyolean-11-en-3β-yl 6-deoxy-α-L-mannopyranosyl-(1→4)-[β-D-glucopyranosyl-(1→6)]-β-D-glucopyranoside |
| Synonyms | Source |
|---|---|
| (3β,16β)-13,28-epoxy-16-hydroxyolean-11-en-3-yl O-6-deoxy-α-L-mannopyranosyl-(1→4)-O-[β-D-glucopyranosyl-(1→6)]-β-D-glucopyranoside | ChEBI |
| saikosaponin-C | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:20736-08-7 | ChemIDplus |
| Citations |
|---|