EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H23N7O6.Ca |
| Net Charge | 0 |
| Average Mass | 497.525 |
| Monoisotopic Mass | 497.13357 |
| SMILES | CN1c2c(nc(N)nc2=O)NC[C@@H]1CNc1ccc(C(=O)N[C@@H](CCC(=O)[O-])C(=O)[O-])cc1.[Ca+2] |
| InChI | InChI=1S/C20H25N7O6.Ca/c1-27-12(9-23-16-15(27)18(31)26-20(21)25-16)8-22-11-4-2-10(3-5-11)17(30)24-13(19(32)33)6-7-14(28)29;/h2-5,12-13,22H,6-9H2,1H3,(H,24,30)(H,28,29)(H,32,33)(H4,21,23,25,26,31);/q;+2/p-2/t12-,13-;/m0./s1 |
| InChIKey | VWBBRFHSPXRJQD-QNTKWALQSA-L |
| Roles Classification |
|---|
| Application: | antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| levomefolate calcium (CHEBI:189695) has part (6S)-5-methyltetrahydrofolate(2−) (CHEBI:18608) |
| levomefolate calcium (CHEBI:189695) has role antidepressant (CHEBI:35469) |
| levomefolate calcium (CHEBI:189695) is a organic calcium salt (CHEBI:51031) |
| IUPAC Name |
|---|
| calcium (2S)-2-[4-({[(6S)-2-amino-5-methyl-4-oxo-3,4,5,6,7,8-hexahydropteridin-6-yl]methyl}amino)benzamido]pentanedioate |
| Synonyms | Source |
|---|---|
| (6S)-5-methyltetrahydrofolic acid calcium salt | ChEBI |
| BAY 86-7660 | ChemIDplus |
| BAY86-7660 | ChemIDplus |
| levomefolinate calcium | ChemIDplus |
| L-methylfolate calcium | ChemIDplus |
| Brand Names | Source |
|---|---|
| Bodyfolin | ChemIDplus |
| Metafolin | ChemIDplus |
| Nutrifolin | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| D09354 | KEGG DRUG |
| DBSALT001276 | DrugBank |
| Registry Numbers | Sources |
|---|---|
| CAS:151533-22-1 | ChemIDplus |
| Citations |
|---|