EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H13N2O |
| Net Charge | +1 |
| Average Mass | 165.216 |
| Monoisotopic Mass | 165.10224 |
| SMILES | Oc1ccc(C2CCC[NH2+]2)cn1 |
| InChI | InChI=1S/C9H12N2O/c12-9-4-3-7(6-11-9)8-2-1-5-10-8/h3-4,6,8,10H,1-2,5H2,(H,11,12)/p+1 |
| InChIKey | CELSHJKHNJIAAJ-UHFFFAOYSA-O |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-hydroxynornicotinium (CHEBI:189657) has functional parent nornicotinium (CHEBI:189656) |
| 6-hydroxynornicotinium (CHEBI:189657) is a pyridine alkaloid (CHEBI:26416) |
| 6-hydroxynornicotinium (CHEBI:189657) is a pyrrolidine alkaloid (CHEBI:26456) |
| UniProt Name | Source |
|---|---|
| 6-hydroxynornicotine | UniProt |
| Citations |
|---|