EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H13N2 |
| Net Charge | +1 |
| Average Mass | 149.217 |
| Monoisotopic Mass | 149.10732 |
| SMILES | c1cncc(C2CCC[NH2+]2)c1 |
| InChI | InChI=1S/C9H12N2/c1-3-8(7-10-5-1)9-4-2-6-11-9/h1,3,5,7,9,11H,2,4,6H2/p+1 |
| InChIKey | MYKUKUCHPMASKF-UHFFFAOYSA-O |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nornicotinium (CHEBI:189656) is a pyridine alkaloid (CHEBI:26416) |
| nornicotinium (CHEBI:189656) is a pyrrolidine alkaloid (CHEBI:26456) |
| Incoming Relation(s) |
| 6-hydroxynornicotinium (CHEBI:189657) has functional parent nornicotinium (CHEBI:189656) |
| (S)-nornicotine(1+) (CHEBI:190184) is a nornicotinium (CHEBI:189656) |
| UniProt Name | Source |
|---|---|
| nornicotine | UniProt |
| Citations |
|---|