EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H5O4.Na |
| Net Charge | 0 |
| Average Mass | 176.103 |
| Monoisotopic Mass | 176.00855 |
| SMILES | O=C([O-])c1cc(O)ccc1O.[Na+] |
| InChI | InChI=1S/C7H6O4.Na/c8-4-1-2-6(9)5(3-4)7(10)11;/h1-3,8-9H,(H,10,11);/q;+1/p-1 |
| InChIKey | MOIJZWWOFOQFMH-UHFFFAOYSA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arabidopsis thaliana (ncbitaxon:3702) | guard cell (BTO:0000544) | MetaboLights (MTBLS1326) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Gentisic acid sodium (CHEBI:189437) has functional parent salicylic acid (CHEBI:16914) |
| Gentisic acid sodium (CHEBI:189437) is a hydroxybenzoic acid (CHEBI:24676) |
| IUPAC Name |
|---|
| sodium;2,5-dihydroxybenzoate |