EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H6N2O7 |
| Net Charge | 0 |
| Average Mass | 182.088 |
| Monoisotopic Mass | 182.01750 |
| SMILES | O=[N+]([O-])OCC(O)CO[N+](=O)[O-] |
| InChI | InChI=1S/C3H6N2O7/c6-3(1-11-4(7)8)2-12-5(9)10/h3,6H,1-2H2 |
| InChIKey | ASIGVDLTBLZXNC-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | vasodilator agent A drug used to cause dilation of the blood vessels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1,3-dinitroglycerol (CHEBI:18921) has role vasodilator agent (CHEBI:35620) |
| 1,3-dinitroglycerol (CHEBI:18921) is a dinitroglycerol (CHEBI:23821) |
| 1,3-dinitroglycerol (CHEBI:18921) is a secondary alcohol (CHEBI:35681) |
| Incoming Relation(s) |
| nitroproston (CHEBI:142127) has functional parent 1,3-dinitroglycerol (CHEBI:18921) |
| IUPAC Name |
|---|
| 2-hydroxypropane-1,3-diyl dinitrate |
| Synonyms | Source |
|---|---|
| 1,2,3-propanetriol, 1,3-dinitrate | ChemIDplus |
| 1,2,3-propanetriol 1,3-dinitrate | ChemIDplus |
| 1,3-dinitroglycerin | ChemIDplus |
| glyceryl-1,3-dinitrate | ChemIDplus |
| 1,3-Dng | ChemIDplus |
| 1,3-glyceryl dinitrate | ChemIDplus |
| UniProt Name | Source |
|---|---|
| 1,3-dinitroglycerol | UniProt |
| Citations |
|---|