EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H5O3 |
| Net Charge | -1 |
| Average Mass | 113.092 |
| Monoisotopic Mass | 113.02442 |
| SMILES | C[C@H]1OC(=O)C=C1[O-] |
| InChI | InChI=1S/C5H6O3/c1-3-4(6)2-5(7)8-3/h2-3,6H,1H3/p-1/t3-/m1/s1 |
| InChIKey | JGAAAWQBYJNOIW-GSVOUGTGSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-5-methyl-tetronate (CHEBI:188931) is a tetronic acid derivative (CHEBI:63455) |
| (R)-5-methyl-tetronate (CHEBI:188931) is conjugate base of (R)-5-methyl-tetronic acid (CHEBI:188930) |
| Incoming Relation(s) |
| peniphenone D(1−) (CHEBI:188935) has functional parent (R)-5-methyl-tetronate (CHEBI:188931) |
| (R)-5-methyl-tetronic acid (CHEBI:188930) is conjugate acid of (R)-5-methyl-tetronate (CHEBI:188931) |
| Synonym | Source |
|---|---|
| (2R)-2-methyl-5-oxo-2,5-dihydrofuran-3-olate | SUBMITTER |
| UniProt Name | Source |
|---|---|
| (R)-5-methyl-tetronate | UniProt |
| Citations |
|---|