EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H6O3 |
| Net Charge | 0 |
| Average Mass | 114.100 |
| Monoisotopic Mass | 114.03169 |
| SMILES | C[C@H]1OC(=O)C=C1O |
| InChI | InChI=1S/C5H6O3/c1-3-4(6)2-5(7)8-3/h2-3,6H,1H3/t3-/m1/s1 |
| InChIKey | JGAAAWQBYJNOIW-GSVOUGTGSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-5-methyl-tetronic acid (CHEBI:188930) is a tetronic acid derivative (CHEBI:63455) |
| (R)-5-methyl-tetronic acid (CHEBI:188930) is conjugate acid of (R)-5-methyl-tetronate (CHEBI:188931) |
| Incoming Relation(s) |
| (R)-5-methyl-tetronate (CHEBI:188931) is conjugate base of (R)-5-methyl-tetronic acid (CHEBI:188930) |
| Citations |
|---|