EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H20O3 |
| Net Charge | 0 |
| Average Mass | 248.322 |
| Monoisotopic Mass | 248.14124 |
| SMILES | CC1=CC(=O)CC(C)(C)C1/C=C/C(C)=C\C(=O)O |
| InChI | InChI=1S/C15H20O3/c1-10(7-14(17)18)5-6-13-11(2)8-12(16)9-15(13,3)4/h5-8,13H,9H2,1-4H3,(H,17,18)/b6-5+,10-7- |
| InChIKey | FCRACOPGPMPSHN-LXGGSRJLSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1'-deoxyabscisic acid (CHEBI:18844) has functional parent 2-cis-abscisic acid (CHEBI:22152) |
| 1'-deoxyabscisic acid (CHEBI:18844) is a oxo monocarboxylic acid (CHEBI:35871) |
| 1'-deoxyabscisic acid (CHEBI:18844) is a α,β-unsaturated monocarboxylic acid (CHEBI:79020) |
| IUPAC Name |
|---|
| (2Z,4E)-3-methyl-5-(2,6,6-trimethyl-4-oxocyclohex-2-en-1-yl)penta-2,4-dienoic acid |
| Synonym | Source |
|---|---|
| (±)-1'-deoxyabscisic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2649145 | Reaxys |