EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H6O5 |
| Net Charge | 0 |
| Average Mass | 134.087 |
| Monoisotopic Mass | 134.02152 |
| SMILES | O=C(O)C[C@@H](O)C(=O)O |
| InChI | InChI=1S/C4H6O5/c5-2(4(8)9)1-3(6)7/h2,5H,1H2,(H,6,7)(H,8,9)/t2-/m1/s1 |
| InChIKey | BJEPYKJPYRNKOW-UWTATZPHSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | food acidity regulator A food additive that is used to change or otherwise control the acidity or alkalinity of foods. They may be acids, bases, neutralising agents or buffering agents. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | fundamental metabolite Any metabolite produced by all living cells. food acidity regulator A food additive that is used to change or otherwise control the acidity or alkalinity of foods. They may be acids, bases, neutralising agents or buffering agents. |
| Application: | food acidity regulator A food additive that is used to change or otherwise control the acidity or alkalinity of foods. They may be acids, bases, neutralising agents or buffering agents. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-malic acid (CHEBI:30796) is a malic acid (CHEBI:6650) |
| (R)-malic acid (CHEBI:30796) is conjugate acid of (R)-malate(2−) (CHEBI:15588) |
| (R)-malic acid (CHEBI:30796) is enantiomer of (S)-malic acid (CHEBI:30797) |
| Incoming Relation(s) |
| (3R)-3-carboxy-3-hydroxypropanoyl-CoA (CHEBI:77653) has functional parent (R)-malic acid (CHEBI:30796) |
| (R)-malate(2−) (CHEBI:15588) is conjugate base of (R)-malic acid (CHEBI:30796) |
| (S)-malic acid (CHEBI:30797) is enantiomer of (R)-malic acid (CHEBI:30796) |
| IUPAC Name |
|---|
| (2R)-2-hydroxybutanedioic acid |
| Synonyms | Source |
|---|---|
| 2-HYDROXY-SUCCINIC ACID | PDBeChem |
| D-Malic acid | KEGG COMPOUND |
| (R)-2-hydroxybutanedioic acid | ChEBI |
| (+)-D-malic acid | ChEBI |
| D-malic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C00497 | KEGG COMPOUND |
| CPD-660 | MetaCyc |
| HMDB0000744 | HMDB |
| Malic_acid | Wikipedia |
| MLT | PDBeChem |
| Citations |
|---|