EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | (C5H8)n.C7H6O3 |
| Net Charge | 0 |
| Average Mass | 206.241 |
| Monoisotopic Mass | 206.09429 |
| SMILES | [H]C/C(C)=C/Cc1cc(C(=O)O)ccc1O |
| InChI | InChI=1S/C12H14O3/c1-8(2)3-4-9-7-10(12(14)15)5-6-11(9)13/h3,5-7,13H,4H2,1-2H3,(H,14,15) |
| InChIKey | LBSJJNAMGVDGCU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-hydroxy-3-polyprenylbenzoic acid (CHEBI:1845) is a monohydroxybenzoic acid (CHEBI:25389) |
| 4-hydroxy-3-polyprenylbenzoic acid (CHEBI:1845) is a olefinic compound (CHEBI:78840) |
| 4-hydroxy-3-polyprenylbenzoic acid (CHEBI:1845) is conjugate acid of 4-hydroxy-3-polyprenylbenzoate (CHEBI:78396) |
| Incoming Relation(s) |
| 4-hydroxy-3-polyprenylbenzoate (CHEBI:78396) is conjugate base of 4-hydroxy-3-polyprenylbenzoic acid (CHEBI:1845) |
| Manual Xrefs | Databases |
|---|---|
| 4-Hydroxy-3-polyprenylbenzoates | MetaCyc |
| C05848 | KEGG COMPOUND |