EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:184119 - (+)-δ-cadinol
| Formula | C15H26O |
| Net Charge | 0 |
| Average Mass | 222.372 |
| Monoisotopic Mass | 222.19837 |
| SMILES | [H][C@@]12CCC(C)=C[C@]1([H])[C@@H](C(C)C)CC[C@]2(C)O |
| InChI | InChI=1S/C15H26O/c1-10(2)12-7-8-15(4,16)14-6-5-11(3)9-13(12)14/h9-10,12-14,16H,5-8H2,1-4H3/t12-,13-,14-,15+/m1/s1 |
| InChIKey | LHYHMMRYTDARSZ-TUVASFSCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Lignosus rhinocerotis (ncbitaxon:483020) | - | PubMed (28606152) | |
| Pinus sibirica (ncbitaxon:62752) | - | DOI (10.1023/A:1019687930921) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-δ-cadinol (CHEBI:184119) has role antineoplastic agent (CHEBI:35610) |
| (+)-δ-cadinol (CHEBI:184119) has role fungal metabolite (CHEBI:76946) |
| (+)-δ-cadinol (CHEBI:184119) has role plant metabolite (CHEBI:76924) |
| (+)-δ-cadinol (CHEBI:184119) is a cadinane sesquiterpenoid (CHEBI:22975) |
| (+)-δ-cadinol (CHEBI:184119) is a octahydronaphthalenes (CHEBI:138397) |
| (+)-δ-cadinol (CHEBI:184119) is a tertiary alcohol (CHEBI:26878) |
| (+)-δ-cadinol (CHEBI:184119) is enantiomer of (−)-δ-cadinol (CHEBI:156223) |
| Incoming Relation(s) |
| (−)-δ-cadinol (CHEBI:156223) is enantiomer of (+)-δ-cadinol (CHEBI:184119) |
| IUPAC Name |
|---|
| (1S,4R,4aS,8aR)-1,6-dimethyl-4-(propan-2-yl)-1,2,3,4,4a,7,8,8a-octahydronaphthalen-1-ol |
| Synonyms | Source |
|---|---|
| sesquigoyol | ChEBI |
| (+)-torreyol | ChEBI |
| UniProt Name | Source |
|---|---|
| (+)-δ-cadinol | UniProt |
| Citations |
|---|