EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H26O |
| Net Charge | 0 |
| Average Mass | 222.372 |
| Monoisotopic Mass | 222.19837 |
| SMILES | [H][C@]12CCC(C)=C[C@@]1([H])[C@H](C(C)C)CC[C@@]2(C)O |
| InChI | InChI=1S/C15H26O/c1-10(2)12-7-8-15(4,16)14-6-5-11(3)9-13(12)14/h9-10,12-14,16H,5-8H2,1-4H3/t12-,13-,14-,15+/m0/s1 |
| InChIKey | LHYHMMRYTDARSZ-ZQDZILKHSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Dictyopteris divaricata (ncbitaxon:156996) | - | PubMed (15497933) | |
| Cistus creticus (ncbitaxon:191224) | - | PubMed (19660770) | |
| Taiwania cryptomerioides (ncbitaxon:50187) | Root (BTO:0001188) | PubMed (12913242) | |
| Pilgerodendron uviferum (ncbitaxon:103979) | - | PubMed (29861480) | |
| Hedychium gardnerianum (ncbitaxon:4647) | - | DOI (10.3390/molecules17033082) |
| Roles Classification |
|---|
| Biological Roles: | algal metabolite Any eukaryotic metabolite produced during a metabolic reaction in algae including unicellular organisms like chlorella and diatoms to multicellular organisms like giant kelps and brown algae. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-δ-cadinol (CHEBI:156223) has role algal metabolite (CHEBI:84735) |
| (−)-δ-cadinol (CHEBI:156223) has role plant metabolite (CHEBI:76924) |
| (−)-δ-cadinol (CHEBI:156223) is a cadinane sesquiterpenoid (CHEBI:22975) |
| (−)-δ-cadinol (CHEBI:156223) is a octahydronaphthalenes (CHEBI:138397) |
| (−)-δ-cadinol (CHEBI:156223) is a tertiary alcohol (CHEBI:26878) |
| (−)-δ-cadinol (CHEBI:156223) is enantiomer of (+)-δ-cadinol (CHEBI:184119) |
| Incoming Relation(s) |
| (+)-δ-cadinol (CHEBI:184119) is enantiomer of (−)-δ-cadinol (CHEBI:156223) |
| IUPAC Name |
|---|
| (1R,4S,4aR,8aS)-1,6-dimethyl-4-(propan-2-yl)-1,2,3,4,4a,7,8,8a-octahydronaphthalen-1-ol |
| Synonyms | Source |
|---|---|
| (−)-torreyol | ChEBI |
| (−)-cedreanol | ChEBI |
| (1R,4S,4aR,8aS)-1,2,3,4,4a,7,8,8a-octahydro-1,6-dimethyl-4-(1-methylethyl)-1-naphthalenol | ChEBI |
| 1-epi-α-cadinol | ChEBI |
| torreyol | ChEBI |
| delta-cadinol | KNApSAcK |
| UniProt Name | Source |
|---|---|
| (−)-δ-cadinol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| Delta-Cadinol | Wikipedia |
| FDB005720 | FooDB |
| C00020150 | KNApSAcK |
| CPD-13861 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| CAS:19435-97-3 | ChemIDplus |
| CAS:19435-97-3 | NIST Chemistry WebBook |
| Citations |
|---|