EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H30O3 |
| Net Charge | 0 |
| Average Mass | 342.479 |
| Monoisotopic Mass | 342.21949 |
| SMILES | C=CC/C=C\C/C=C\CCCCCCCc1cccc(O)c1C(=O)O |
| InChI | InChI=1S/C22H30O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-16-19-17-15-18-20(23)21(19)22(24)25/h2,4-5,7-8,15,17-18,23H,1,3,6,9-14,16H2,(H,24,25)/b5-4-,8-7- |
| InChIKey | QUVGEKPNSCFQIR-UTOQUPLUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bombus terrestris (ncbitaxon:30195) | |||
| brain (BTO:0000142) | MetaboLights (MTBLS3637) | ||
| hemolymph (BTO:0000572) | MetaboLights (MTBLS3637) | ||
| hindgut (BTO:0000510) | MetaboLights (MTBLS3637) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-hydroxy-6-[(8Z,11Z)-pentadeca-8,11,14-trien-1-yl]benzoic acid (CHEBI:183726) has functional parent salicylic acid (CHEBI:16914) |
| 2-hydroxy-6-[(8Z,11Z)-pentadeca-8,11,14-trien-1-yl]benzoic acid (CHEBI:183726) is a hydroxybenzoic acid (CHEBI:24676) |
| IUPAC Name |
|---|
| 2-hydroxy-6-[(8Z,11Z)-pentadeca-8,11,14-trienyl]benzoic acid |
| Manual Xrefs | Databases |
|---|---|
| LMPK15040001 | LIPID MAPS |
| 8050818 | ChemSpider |