EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H25ClN2O5 |
| Net Charge | 0 |
| Average Mass | 480.948 |
| Monoisotopic Mass | 480.14520 |
| SMILES | Cc1ccccc1C(=O)Nc1ccc(C(=O)Nc2ccc(Cl)cc2C(O)CCC(=O)O)c(C)c1 |
| InChI | InChI=1S/C26H25ClN2O5/c1-15-5-3-4-6-19(15)25(33)28-18-8-9-20(16(2)13-18)26(34)29-22-10-7-17(27)14-21(22)23(30)11-12-24(31)32/h3-10,13-14,23,30H,11-12H2,1-2H3,(H,28,33)(H,29,34)(H,31,32) |
| InChIKey | AJMZAIPORREFDJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| DM-4107 (CHEBI:183656) has functional parent tolvaptan (CHEBI:32246) |
| DM-4107 (CHEBI:183656) has role drug metabolite (CHEBI:49103) |
| DM-4107 (CHEBI:183656) is a 4-hydroxy monocarboxylic acid (CHEBI:35970) |
| DM-4107 (CHEBI:183656) is a benzenedicarboxamide (CHEBI:38800) |
| IUPAC Name |
|---|
| 4-{5-chloro-2-[2-methyl-4-(2-methylbenzamido)benzamido]phenyl}-4-hydroxybutanoic acid |
| Citations |
|---|