EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H45N3O6S2 |
| Net Charge | 0 |
| Average Mass | 559.795 |
| Monoisotopic Mass | 559.27498 |
| SMILES | CC[C@H](C)[C@@H](COC(Cc1ccccc1)C(=O)N[C@@H](CCS(C)(=O)=O)C(=O)OC(C)C)NC[C@@H](N)CS |
| InChI | InChI=1S/C26H45N3O6S2/c1-6-19(4)23(28-15-21(27)17-36)16-34-24(14-20-10-8-7-9-11-20)25(30)29-22(12-13-37(5,32)33)26(31)35-18(2)3/h7-11,18-19,21-24,28,36H,6,12-17,27H2,1-5H3,(H,29,30)/t19-,21+,22-,23+,24?/m0/s1 |
| InChIKey | PGOKBMWPBDRDGN-SIPQYZPLSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 2.5.1.58 (protein farnesyltransferase) inhibitor An EC 2.5.1.* (non-methyl-alkyl or aryl transferase) inhibitor that interferes with the action of protein farnesyltransferase (EC 2.5.1.58), one of the three enzymes in the prenyltransferase group. |
| Applications: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-744,832 (CHEBI:183636) has role antineoplastic agent (CHEBI:35610) |
| L-744,832 (CHEBI:183636) has role EC 2.5.1.58 (protein farnesyltransferase) inhibitor (CHEBI:64133) |
| L-744,832 (CHEBI:183636) has role geroprotector (CHEBI:176497) |
| L-744,832 (CHEBI:183636) is a benzenes (CHEBI:22712) |
| L-744,832 (CHEBI:183636) is a ether (CHEBI:25698) |
| L-744,832 (CHEBI:183636) is a isopropyl ester (CHEBI:35725) |
| L-744,832 (CHEBI:183636) is a secondary carboxamide (CHEBI:140325) |
| L-744,832 (CHEBI:183636) is a sulfone (CHEBI:35850) |
| L-744,832 (CHEBI:183636) is a thiol (CHEBI:29256) |
| IUPAC Name |
|---|
| propan-2-yl (2S)-2-(2-{[(2S,3S)-2-{[(2R)-2-amino-3-sulfanylpropyl]amino}-3-methylpentyl]oxy}-3-phenylpropanamido)-4-(methylsulfonyl)butanoate |
| Synonyms | Source |
|---|---|
| L 744,832 | ChemIDplus |
| L 744832 | ChemIDplus |
| L-744832 | ChemIDplus |
| L744832 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:160141-09-3 | ChemIDplus |
| Citations |
|---|