EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H7NO3 |
| Net Charge | 0 |
| Average Mass | 189.170 |
| Monoisotopic Mass | 189.04259 |
| SMILES | O=C(O)c1cc(O)c2ccccc2n1 |
| InChI | InChI=1S/C10H7NO3/c12-9-5-8(10(13)14)11-7-4-2-1-3-6(7)9/h1-5H,(H,11,12)(H,13,14) |
| InChIKey | HCZHHEIFKROPDY-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24678285) | Source: yeast.sf.net |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | NMDA receptor antagonist Any substance that inhibits the action of N-methyl-D-aspartate (NMDA) receptors. They tend to induce a state known as dissociative anesthesia, marked by catalepsy, amnesia, and analgesia, while side effects can include hallucinations, nightmares, and confusion. Due to their psychotomimetic effects, many NMDA receptor antagonists are used as recreational drugs. nicotinic antagonist An antagonist at the nicotinic cholinergic receptor. G-protein-coupled receptor agonist An agonist that binds to and activates G-protein-coupled receptors Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| Applications: | nicotinic antagonist An antagonist at the nicotinic cholinergic receptor. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| kynurenic acid (CHEBI:18344) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| kynurenic acid (CHEBI:18344) has role G-protein-coupled receptor agonist (CHEBI:70998) |
| kynurenic acid (CHEBI:18344) has role human metabolite (CHEBI:77746) |
| kynurenic acid (CHEBI:18344) has role neuroprotective agent (CHEBI:63726) |
| kynurenic acid (CHEBI:18344) has role nicotinic antagonist (CHEBI:48878) |
| kynurenic acid (CHEBI:18344) has role NMDA receptor antagonist (CHEBI:60643) |
| kynurenic acid (CHEBI:18344) is a monohydroxyquinoline (CHEBI:38775) |
| kynurenic acid (CHEBI:18344) is a quinolinemonocarboxylic acid (CHEBI:26512) |
| kynurenic acid (CHEBI:18344) is conjugate acid of kynurenate (CHEBI:58454) |
| Incoming Relation(s) |
| 4-hydroxy-8-methoxyquinaldic acid (CHEBI:2323) has functional parent kynurenic acid (CHEBI:18344) |
| 7,8-dihydro-7,8-dihydroxykynurenic acid (CHEBI:17109) has functional parent kynurenic acid (CHEBI:18344) |
| 7,8-dihydroxykynurenic acid (CHEBI:17508) has functional parent kynurenic acid (CHEBI:18344) |
| kynurenate (CHEBI:58454) is conjugate base of kynurenic acid (CHEBI:18344) |
| IUPAC Name |
|---|
| 4-hydroxyquinoline-2-carboxylic acid |
| Synonyms | Source |
|---|---|
| 4-Hydroxy-2-chinolincarbonsäure | ChEBI |
| 4-hydroxy-2-quinolinecarboxylic acid | ChEBI |
| 4-Hydroxy-2-quinolinecarboxylic acid | KEGG COMPOUND |
| 4-hydroxyquinaldic acid | ChemIDplus |
| 4-hydroxyquinaldinic acid | ChemIDplus |
| Kynurenate | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00026453 | KNApSAcK |
| C00026494 | KNApSAcK |
| C01717 | KEGG COMPOUND |
| HMDB0000715 | HMDB |
| KYA | PDBeChem |
| KYNURENATE | MetaCyc |
| Kynurenic_acid | Wikipedia |
| LSM-24962 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:147451 | Reaxys |
| CAS:492-27-3 | ChemIDplus |
| CAS:492-27-3 | KEGG COMPOUND |
| Citations |
|---|