EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H7NO5 |
| Net Charge | 0 |
| Average Mass | 221.168 |
| Monoisotopic Mass | 221.03242 |
| SMILES | O=C(O)c1cc(O)c2ccc(O)c(O)c2n1 |
| InChI | InChI=1S/C10H7NO5/c12-6-2-1-4-7(13)3-5(10(15)16)11-8(4)9(6)14/h1-3,12,14H,(H,11,13)(H,15,16) |
| InChIKey | TYPRWJJYCBNAQC-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7,8-dihydroxykynurenic acid (CHEBI:17508) has functional parent kynurenic acid (CHEBI:18344) |
| 7,8-dihydroxykynurenic acid (CHEBI:17508) is a hydroxyquinoline (CHEBI:38774) |
| 7,8-dihydroxykynurenic acid (CHEBI:17508) is a quinolinemonocarboxylic acid (CHEBI:26512) |
| 7,8-dihydroxykynurenic acid (CHEBI:17508) is conjugate acid of 7,8-dihydroxykynurenate (CHEBI:58171) |
| Incoming Relation(s) |
| 7,8-dihydroxykynurenate (CHEBI:58171) is conjugate base of 7,8-dihydroxykynurenic acid (CHEBI:17508) |
| IUPAC Name |
|---|
| 4,7,8-trihydroxyquinoline-2-carboxylic acid |
| Synonym | Source |
|---|---|
| 7,8-Dihydroxykynurenate | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C01111 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:407716 | Reaxys |