EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H18N2O3 |
| Net Charge | 0 |
| Average Mass | 262.309 |
| Monoisotopic Mass | 262.13174 |
| SMILES | Cc1cc(NC(=O)c2cc(C(C)(C)C)oc2C)no1 |
| InChI | InChI=1S/C14H18N2O3/c1-8-6-12(16-19-8)15-13(17)10-7-11(14(3,4)5)18-9(10)2/h6-7H,1-5H3,(H,15,16,17) |
| InChIKey | PWZOFJUSZGILSP-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bombus terrestris (ncbitaxon:30195) | |||
| brain (BTO:0000142) | MetaboLights (MTBLS3637) | ||
| hindgut (BTO:0000510) | MetaboLights (MTBLS3637) | ||
| hemolymph (BTO:0000572) | MetaboLights (MTBLS3637) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-(tert-butyl)-2-methyl-N-(5-methyl-3-isoxazolyl)-3-furamide (CHEBI:183329) has functional parent 3-furoic acid (CHEBI:30846) |
| 5-(tert-butyl)-2-methyl-N-(5-methyl-3-isoxazolyl)-3-furamide (CHEBI:183329) is a furoic acid (CHEBI:36055) |
| IUPAC Name |
|---|
| 5-tert-butyl-2-methyl-N-(5-methyl-1,2-oxazol-3-yl)uran-3-carboxamide |
| Manual Xrefs | Databases |
|---|---|
| 2090340 | ChemSpider |