EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H30NO2 |
| Net Charge | +1 |
| Average Mass | 340.487 |
| Monoisotopic Mass | 340.22711 |
| SMILES | C[C@@H](C[NH+]1CCC(Cc2ccccc2)CC1)[C@@H](O)c1ccc(O)cc1 |
| InChI | InChI=1S/C22H29NO2/c1-17(22(25)20-7-9-21(24)10-8-20)16-23-13-11-19(12-14-23)15-18-5-3-2-4-6-18/h2-10,17,19,22,24-25H,11-16H2,1H3/p+1/t17-,22+/m0/s1 |
| InChIKey | WVZSEUPGUDIELE-HTAPYJJXSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ro 25-6981(1+) (CHEBI:183314) is a piperidinium ion (CHEBI:48633) |
| Ro 25-6981(1+) (CHEBI:183314) is conjugate acid of Ro 25-6981 (CHEBI:92897) |
| Incoming Relation(s) |
| Ro 25-6981 maleate (CHEBI:180901) has part Ro 25-6981(1+) (CHEBI:183314) |
| Ro 25-6981 (CHEBI:92897) is conjugate base of Ro 25-6981(1+) (CHEBI:183314) |
| IUPAC Name |
|---|
| 4-benzyl-1-[(2S,3R)-3-hydroxy-3-(4-hydroxyphenyl)-2-methylpropyl]piperidinium |
| Synonyms | Source |
|---|---|
| Ro 25-6981 cation | ChEBI |
| Ro25-6981 cation | ChEBI |
| Ro-25-6981 cation | ChEBI |